Salts and Inorganics
Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Fisher Science Education™ Silver Nitrate
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
Fisher Science Education™ Magnesium Chloride, Hexahydrate
CAS: 7791-18-6 Molecular Formula: Cl2H12MgO6 Molecular Weight (g/mol): 203.30 MDL Number: MFCD00149781 InChI Key: DHRRIBDTHFBPNG-UHFFFAOYSA-L Synonym: Magnesium Dichloride Hexahydrate IUPAC Name: magnesium(2+) hexahydrate dichloride SMILES: O.O.O.O.O.O.[Mg++].[Cl-].[Cl-]
| CAS | 7791-18-6 |
|---|---|
| Molecular Weight (g/mol) | 203.30 |
| MDL Number | MFCD00149781 |
| SMILES | O.O.O.O.O.O.[Mg++].[Cl-].[Cl-] |
| Synonym | Magnesium Dichloride Hexahydrate |
| IUPAC Name | magnesium(2+) hexahydrate dichloride |
| InChI Key | DHRRIBDTHFBPNG-UHFFFAOYSA-L |
| Molecular Formula | Cl2H12MgO6 |
Fisher Science Education™ Calcium Carbide
CAS: 75-20-7 Synonym: calcium carbide,3-phenoxypropylene di acetate,glycerol phenyl ether diacetate,3-phenoxy-1,2-propanediol diacetate,phenylglyceryl ether diacetate,1-phenyl ether-2,3-diacetate glycerol,1,2-propanediol, 3-phenoxy-, diacetate,1-acetyloxy-3-phenoxypropan-2-yl acetate,quartz crystal,3-phenoxypropane-1,2-diyl diacetate
| CAS | 75-20-7 |
|---|---|
| Synonym | calcium carbide,3-phenoxypropylene di acetate,glycerol phenyl ether diacetate,3-phenoxy-1,2-propanediol diacetate,phenylglyceryl ether diacetate,1-phenyl ether-2,3-diacetate glycerol,1,2-propanediol, 3-phenoxy-, diacetate,1-acetyloxy-3-phenoxypropan-2-yl acetate,quartz crystal,3-phenoxypropane-1,2-diyl diacetate |
Fisher Science Education™ Calcium
CAS: 7440-70-2 Molecular Formula: Ca Molecular Weight (g/mol): 40.08 MDL Number: MFCD00010897 MFCD00085314 InChI Key: OYPRJOBELJOOCE-UHFFFAOYSA-N Synonym: unii-sy7q814vup,hsdb 273,sy7q814vup,compounds,elemental,calcium, elemental,kalzium,atom,ingot,chelate PubChem CID: 5460341 ChEBI: CHEBI:29320 IUPAC Name: calcium SMILES: [Ca]
| PubChem CID | 5460341 |
|---|---|
| CAS | 7440-70-2 |
| Molecular Weight (g/mol) | 40.08 |
| ChEBI | CHEBI:29320 |
| MDL Number | MFCD00010897 MFCD00085314 |
| SMILES | [Ca] |
| Synonym | unii-sy7q814vup,hsdb 273,sy7q814vup,compounds,elemental,calcium, elemental,kalzium,atom,ingot,chelate |
| IUPAC Name | calcium |
| InChI Key | OYPRJOBELJOOCE-UHFFFAOYSA-N |
| Molecular Formula | Ca |
Fisher Science Education™ Copper (II) Nitrate, Trihydrate
CAS: 10031-43-3 Molecular Formula: CuH6N2O9 Molecular Weight (g/mol): 241.599 InChI Key: SXTLQDJHRPXDSB-UHFFFAOYSA-N Synonym: copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem PubChem CID: 9837674 IUPAC Name: copper;dinitrate;trihydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2]
| PubChem CID | 9837674 |
|---|---|
| CAS | 10031-43-3 |
| Molecular Weight (g/mol) | 241.599 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2] |
| Synonym | copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem |
| IUPAC Name | copper;dinitrate;trihydrate |
| InChI Key | SXTLQDJHRPXDSB-UHFFFAOYSA-N |
| Molecular Formula | CuH6N2O9 |
Fisher Science Education™ Copper (II) Sulfate
CAS: 7758-99-8 Molecular Formula: CuH10O9S Molecular Weight (g/mol): 249.68 MDL Number: MFCD00149681 InChI Key: JZCCFEFSEZPSOG-UHFFFAOYSA-L Synonym: copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas PubChem CID: 24463 ChEBI: CHEBI:31440 IUPAC Name: copper(2+) pentahydrate sulfate SMILES: O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O
| PubChem CID | 24463 |
|---|---|
| CAS | 7758-99-8 |
| Molecular Weight (g/mol) | 249.68 |
| ChEBI | CHEBI:31440 |
| MDL Number | MFCD00149681 |
| SMILES | O.O.O.O.O.[Cu++].[O-]S([O-])(=O)=O |
| Synonym | copper ii sulfate pentahydrate,copper sulfate pentahydrate,cupric sulfate pentahydrate,blue vitriol,calcanthite,bluestone,copper 2+ sulfate pentahydrate,triangle,vencedor,blue copperas |
| IUPAC Name | copper(2+) pentahydrate sulfate |
| InChI Key | JZCCFEFSEZPSOG-UHFFFAOYSA-L |
| Molecular Formula | CuH10O9S |
Fisher Science Education™ Ferric Nitrate Solution, 1M
CAS: 7782-61-8 Molecular Formula: FeH18N3O18 Molecular Weight (g/mol): 403.99 MDL Number: MFCD00149708 InChI Key: SZQUEWJRBJDHSM-UHFFFAOYSA-N Synonym: ferric nitrate nonahydrate,iron iii nitrate nonahydrate,unii-vmx4uop3vn,ferric nitrate, nonahydrate,iron iii nitrate,vmx4uop3vn,iron, reference standard solution,ferricnitratenonahydrate,nitric acid, iron 3+ salt, nonahydrate,iron iii nitrate hydrate PubChem CID: 16211566 IUPAC Name: iron(3+) nonahydrate trinitrate SMILES: O.O.O.O.O.O.O.O.O.[Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 16211566 |
|---|---|
| CAS | 7782-61-8 |
| Molecular Weight (g/mol) | 403.99 |
| MDL Number | MFCD00149708 |
| SMILES | O.O.O.O.O.O.O.O.O.[Fe+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | ferric nitrate nonahydrate,iron iii nitrate nonahydrate,unii-vmx4uop3vn,ferric nitrate, nonahydrate,iron iii nitrate,vmx4uop3vn,iron, reference standard solution,ferricnitratenonahydrate,nitric acid, iron 3+ salt, nonahydrate,iron iii nitrate hydrate |
| IUPAC Name | iron(3+) nonahydrate trinitrate |
| InChI Key | SZQUEWJRBJDHSM-UHFFFAOYSA-N |
| Molecular Formula | FeH18N3O18 |
Fisher Science Education™ Potassium Dichromate
CAS: 7778-50-9 Molecular Formula: Cr2K2O7 Molecular Weight (g/mol): 294.182 InChI Key: KMUONIBRACKNSN-UHFFFAOYSA-N Synonym: potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash PubChem CID: 24502 ChEBI: CHEBI:53444 IUPAC Name: dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium SMILES: [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+]
| PubChem CID | 24502 |
|---|---|
| CAS | 7778-50-9 |
| Molecular Weight (g/mol) | 294.182 |
| ChEBI | CHEBI:53444 |
| SMILES | [O-][Cr](=O)(=O)O[Cr](=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium dichromate,potassium bichromate,kaliumdichromat,iopezite,dipotassium bichromate,dipotassium dichromate,potassium dichromate vi,dichromic acid dipotassium salt,dipotassium dichromium heptaoxide,bichromate of potash |
| IUPAC Name | dipotassium;oxido-(oxido(dioxo)chromio)oxy-dioxochromium |
| InChI Key | KMUONIBRACKNSN-UHFFFAOYSA-N |
| Molecular Formula | Cr2K2O7 |
Fisher Science Education™ Potassium Chromate
CAS: 7789-00-6 Molecular Formula: CrK2O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00011368 InChI Key: XMXNVYPJWBTAHN-UHFFFAOYSA-N Synonym: potassium chromate,bipotassium chromate,potassium chromate vi,dipotassium monochromate,dipotassium chromate,tarapacaite,chromate of potash,chromate of potass,neutral potassium chromate,caswell no. 687 PubChem CID: 24597 ChEBI: CHEBI:75249 IUPAC Name: dipotassium dioxochromiumbis(olate) SMILES: [K+].[K+].[O-][Cr]([O-])(=O)=O
| PubChem CID | 24597 |
|---|---|
| CAS | 7789-00-6 |
| Molecular Weight (g/mol) | 194.19 |
| ChEBI | CHEBI:75249 |
| MDL Number | MFCD00011368 |
| SMILES | [K+].[K+].[O-][Cr]([O-])(=O)=O |
| Synonym | potassium chromate,bipotassium chromate,potassium chromate vi,dipotassium monochromate,dipotassium chromate,tarapacaite,chromate of potash,chromate of potass,neutral potassium chromate,caswell no. 687 |
| IUPAC Name | dipotassium dioxochromiumbis(olate) |
| InChI Key | XMXNVYPJWBTAHN-UHFFFAOYSA-N |
| Molecular Formula | CrK2O4 |
Fisher Science Education™ Potassium Phosphate Monobasic
CAS: 7778-77-0 Molecular Formula: H2KO4P Molecular Weight (g/mol): 136.08 MDL Number: MFCD00011401 MFCD00147253 InChI Key: GNSKLFRGEWLPPA-UHFFFAOYSA-M Synonym: potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate PubChem CID: 516951 ChEBI: CHEBI:63036 IUPAC Name: potassium dihydrogen phosphate SMILES: [K+].OP(O)([O-])=O
| PubChem CID | 516951 |
|---|---|
| CAS | 7778-77-0 |
| Molecular Weight (g/mol) | 136.08 |
| ChEBI | CHEBI:63036 |
| MDL Number | MFCD00011401 MFCD00147253 |
| SMILES | [K+].OP(O)([O-])=O |
| Synonym | potassium dihydrogen phosphate,monopotassium phosphate,potassium phosphate monobasic,potassium phosphate, monobasic,potassium acid phosphate,phosphoric acid, monopotassium salt,monobasic potassium phosphate,monopotassium monophosphate,monopotassium dihydrogen phosphate,monopotassium orthophosphate |
| IUPAC Name | potassium dihydrogen phosphate |
| InChI Key | GNSKLFRGEWLPPA-UHFFFAOYSA-M |
| Molecular Formula | H2KO4P |
Fisher Science Education™ Silver Oxide
CAS: 20667-12-3 Molecular Formula: Ag2O Molecular Weight (g/mol): 231.74 MDL Number: MFCD00003404 InChI Key: KHJDQHIZCZTCAE-UHFFFAOYSA-N Synonym: Argentous Oxide IUPAC Name: (argentiooxy)silver SMILES: [Ag]O[Ag]
| CAS | 20667-12-3 |
|---|---|
| Molecular Weight (g/mol) | 231.74 |
| MDL Number | MFCD00003404 |
| SMILES | [Ag]O[Ag] |
| Synonym | Argentous Oxide |
| IUPAC Name | (argentiooxy)silver |
| InChI Key | KHJDQHIZCZTCAE-UHFFFAOYSA-N |
| Molecular Formula | Ag2O |
Fisher Science Education™ Sodium Metal
CAS: 7440-23-5 Molecular Formula: Na Molecular Weight (g/mol): 22.99 MDL Number: MFCD00085307 InChI Key: KEAYESYHFKHZAL-UHFFFAOYSA-N Synonym: natrium,sodium-23,sodio,metal,sodio spanish,liquid alloy,unii-9nez333n27,hsdb 687,unii-23j3bhr95o,ingot PubChem CID: 5360545 ChEBI: CHEBI:26708 IUPAC Name: sodium SMILES: [Na]
| PubChem CID | 5360545 |
|---|---|
| CAS | 7440-23-5 |
| Molecular Weight (g/mol) | 22.99 |
| ChEBI | CHEBI:26708 |
| MDL Number | MFCD00085307 |
| SMILES | [Na] |
| Synonym | natrium,sodium-23,sodio,metal,sodio spanish,liquid alloy,unii-9nez333n27,hsdb 687,unii-23j3bhr95o,ingot |
| IUPAC Name | sodium |
| InChI Key | KEAYESYHFKHZAL-UHFFFAOYSA-N |
| Molecular Formula | Na |
Fisher Science Education™ Strontium Chloride, Hexahydrate
CAS: 10025-70-4 Molecular Formula: Cl2H12O6Sr Molecular Weight (g/mol): 266.61 MDL Number: MFCD00149865 InChI Key: AMGRXJSJSONEEG-UHFFFAOYSA-L IUPAC Name: strontium(2+) hexahydrate dichloride SMILES: O.O.O.O.O.O.[Cl-].[Cl-].[Sr++]
| CAS | 10025-70-4 |
|---|---|
| Molecular Weight (g/mol) | 266.61 |
| MDL Number | MFCD00149865 |
| SMILES | O.O.O.O.O.O.[Cl-].[Cl-].[Sr++] |
| IUPAC Name | strontium(2+) hexahydrate dichloride |
| InChI Key | AMGRXJSJSONEEG-UHFFFAOYSA-L |
| Molecular Formula | Cl2H12O6Sr |
Fisher Science Education™ Zinc, Strips, 2 in. x 1/4 in.
CAS: 7440-66-6 Synonym: 1 mmHg at 487degreeC
| CAS | 7440-66-6 |
|---|---|
| Synonym | 1 mmHg at 487degreeC |